C48H63FO4S — CID 89023154
[2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate (PubChem CID 89023154) has the molecular formula C48H63FO4S and a molecular weight of 755.09 g/mol. Its IUPAC name is [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate.
| Compound Name | [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
|---|---|
| PubChem CID | 89023154 |
| Molecular Formula | C48H63FO4S |
| Molecular Weight | 755.09 g/mol |
| Exact Mass | 754.44 |
| IUPAC Name | [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
| SMILES | CC1=C(CC(=O)Oc2cc(C)c3c(c2C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C48H63FO4S/c1-31(2)13-10-14-32(3)15-11-16-33(4)17-12-25-48(8)26-24-40-36(7)45(27-34(5)47(40)53-48)52-46(50)30-43-35(6)42(41-23-20-38(49)29-44(41)43)28-37-18-21-39(22-19-37)54(9)51/h18-23,27-29,31-33H,10-17,24-26,30H2,1-9H3/b42-28- |
| InChIKey | YMXTXOOSFSPTKE-RKMIRMFUSA-N |
| XLogP | 13.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.09 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|