C15H11FN4O4 — CID 89023206
ethyl 3-(4-fluoro-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-1H-pyrazole-5-carboxylate (PubChem CID 89023206) has the molecular formula C15H11FN4O4 and a molecular weight of 330.28 g/mol. Its IUPAC name is ethyl 3-(4-fluoro-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-fluoro-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 89023206 |
| Molecular Formula | C15H11FN4O4 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | ethyl 3-(4-fluoro-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ncc(F)c3c(C(=O)C=O)c[nH]c23)n[nH]1 |
| InChI | InChI=1S/C15H11FN4O4/c1-2-24-15(23)10-3-9(19-20-10)13-14-12(8(16)5-18-13)7(4-17-14)11(22)6-21/h3-6,17H,2H2,1H3,(H,19,20) |
| InChIKey | FICMGJIUXJMZRJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|