About cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone
cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone (PubChem CID 89023366) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone |
| PubChem CID | 89023366 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(C1=CCCC1)N1C=CCC1 |
| InChI | InChI=1S/C10H13NO/c12-10(9-5-1-2-6-9)11-7-3-4-8-11/h3,5,7H,1-2,4,6,8H2 |
| InChIKey | QHZWDSMQSADIBS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone?
The IUPAC name of cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone (CID 89023366) is cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone.
What is the SMILES notation for cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone?
The canonical SMILES for cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone is O=C(C1=CCCC1)N1C=CCC1.
What is the InChIKey of cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone?
The InChIKey is QHZWDSMQSADIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c12-10(9-5-1-2-6-9)11-7-3-4-8-11/h3,5,7H,1-2,4,6,8H2.
What are the key properties of cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone?
cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone has a molecular weight of 163.22 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl(2,3-dihydropyrrol-1-yl)methanone is sourced from PubChem (CID 89023366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).