C19H16F12O9 — CID 89023614
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanedioate (PubChem CID 89023614) has the molecular formula C19H16F12O9 and a molecular weight of 616.30 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanedioate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanedioate |
|---|---|
| PubChem CID | 89023614 |
| Molecular Formula | C19H16F12O9 |
| Molecular Weight | 616.30 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanedioate |
| SMILES | CC1C(=O)OC2C3OC(C)(C(CC(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F)OC3OC12 |
| InChI | InChI=1S/C19H16F12O9/c1-4-7-8(36-10(4)33)9-12(37-7)40-15(2,39-9)5(11(34)38-14(18(26,27)28)19(29,30)31)3-6(32)35-13(16(20,21)22)17(23,24)25/h4-5,7-9,12-14H,3H2,1-2H3 |
| InChIKey | YXYDBYVTRQBBHT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|