C33H51NO5 — CID 89023615
(2,5-dioxopyrrolidin-1-yl) 2-[[(3S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetate (PubChem CID 89023615) has the molecular formula C33H51NO5 and a molecular weight of 541.77 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[(3S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[(3S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 89023615 |
| Molecular Formula | C33H51NO5 |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[(3S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C[C@@H](OCC(=O)ON5C(=O)CCC5=O)CCC4(C)C3CC[C@]12C |
| InChI | InChI=1S/C33H51NO5/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-24(15-17-32(23,4)28(25)16-18-33(26,27)5)38-20-31(37)39-34-29(35)13-14-30(34)36/h9,21-22,24-28H,6-8,10-20H2,1-5H3/t22?,24-,25?,26?,27?,28?,32?,33+/m0/s1 |
| InChIKey | BXMFAOBBVYPMFF-WMEWAYCVSA-N |
| XLogP | 7.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|