About 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide
4-propan-2-yl-1,3-thiazole-2-carbonyl iodide (PubChem CID 89023690) has the molecular formula C7H8INOS
and a molecular weight of 281.12 g/mol. Its IUPAC name is 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide.
Molecular Properties
| Compound Name | 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide |
| PubChem CID | 89023690 |
| Molecular Formula | C7H8INOS |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 280.94 |
| IUPAC Name | 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide |
| SMILES | CC(C)c1csc(C(=O)I)n1 |
| InChI | InChI=1S/C7H8INOS/c1-4(2)5-3-11-7(9-5)6(8)10/h3-4H,1-2H3 |
| InChIKey | BXRNJQMZDOBLBS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide?
The IUPAC name of 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide (CID 89023690) is 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide.
What is the SMILES notation for 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide?
The canonical SMILES for 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide is CC(C)c1csc(C(=O)I)n1.
What is the InChIKey of 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide?
The InChIKey is BXRNJQMZDOBLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8INOS/c1-4(2)5-3-11-7(9-5)6(8)10/h3-4H,1-2H3.
What are the key properties of 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide?
4-propan-2-yl-1,3-thiazole-2-carbonyl iodide has a molecular weight of 281.12 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1,3-thiazole-2-carbonyl iodide is sourced from PubChem (CID 89023690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).