C29H46O7Si — CID 89023995
trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxy-3-methylbenzoate (PubChem CID 89023995) has the molecular formula C29H46O7Si and a molecular weight of 534.77 g/mol. Its IUPAC name is trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxy-3-methylbenzoate.
| Compound Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxy-3-methylbenzoate |
|---|---|
| PubChem CID | 89023995 |
| Molecular Formula | C29H46O7Si |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxy-3-methylbenzoate |
| SMILES | COc1cc(OC)c(C(=O)OC[Si](C)(C)C)c(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(C)/C=C\C[C@@H](C)O)c1C |
| InChI | InChI=1S/C29H46O7Si/c1-19(13-11-14-20(2)30)27-23(35-29(4,5)36-27)16-12-15-22-21(3)24(32-6)17-25(33-7)26(22)28(31)34-18-37(8,9)10/h11-13,15,17,19-20,23,27,30H,14,16,18H2,1-10H3/b13-11-,15-12+/t19?,20-,23+,27-/m1/s1 |
| InChIKey | YCFGHKBOLZNEIG-JKPPVXAUSA-N |
| XLogP | 5.93 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|