C28H44O7Si — CID 89023999
trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxybenzoate (PubChem CID 89023999) has the molecular formula C28H44O7Si and a molecular weight of 520.74 g/mol. Its IUPAC name is trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxybenzoate.
| Compound Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 89023999 |
| Molecular Formula | C28H44O7Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethoxybenzoate |
| SMILES | COc1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(C)/C=C\C[C@@H](C)O)c(C(=O)OC[Si](C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C28H44O7Si/c1-19(12-10-13-20(2)29)26-23(34-28(3,4)35-26)15-11-14-21-16-22(31-5)17-24(32-6)25(21)27(30)33-18-36(7,8)9/h10-12,14,16-17,19-20,23,26,29H,13,15,18H2,1-9H3/b12-10-,14-11+/t19?,20-,23+,26-/m1/s1 |
| InChIKey | WVDYMIYKPGAKDO-GNQNREFKSA-N |
| XLogP | 5.62 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|