About (6S)-6-methyl-6,7-dihydroisoquinoline
(6S)-6-methyl-6,7-dihydroisoquinoline (PubChem CID 89024028) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is (6S)-6-methyl-6,7-dihydroisoquinoline.
Molecular Properties
| Compound Name | (6S)-6-methyl-6,7-dihydroisoquinoline |
| PubChem CID | 89024028 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (6S)-6-methyl-6,7-dihydroisoquinoline |
| SMILES | C[C@@H]1C=c2ccncc2=CC1 |
| InChI | InChI=1S/C10H11N/c1-8-2-3-10-7-11-5-4-9(10)6-8/h3-8H,2H2,1H3/t8-/m0/s1 |
| InChIKey | HESMYVHAGTVECR-QMMMGPOBSA-N |
| XLogP | 0.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-6-methyl-6,7-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-methyl-6,7-dihydroisoquinoline?
The IUPAC name of (6S)-6-methyl-6,7-dihydroisoquinoline (CID 89024028) is (6S)-6-methyl-6,7-dihydroisoquinoline.
What is the SMILES notation for (6S)-6-methyl-6,7-dihydroisoquinoline?
The canonical SMILES for (6S)-6-methyl-6,7-dihydroisoquinoline is C[C@@H]1C=c2ccncc2=CC1.
What is the InChIKey of (6S)-6-methyl-6,7-dihydroisoquinoline?
The InChIKey is HESMYVHAGTVECR-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11N/c1-8-2-3-10-7-11-5-4-9(10)6-8/h3-8H,2H2,1H3/t8-/m0/s1.
What are the key properties of (6S)-6-methyl-6,7-dihydroisoquinoline?
(6S)-6-methyl-6,7-dihydroisoquinoline has a molecular weight of 145.20 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-methyl-6,7-dihydroisoquinoline is sourced from PubChem (CID 89024028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).