About (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one
(5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one (PubChem CID 89024034) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one |
| PubChem CID | 89024034 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one |
| SMILES | C[C@H]1C=c2[nH]c(=O)oc2=CC1 |
| InChI | InChI=1S/C8H9NO2/c1-5-2-3-7-6(4-5)9-8(10)11-7/h3-5H,2H2,1H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | GFHFXZJAUCJXCE-RXMQYKEDSA-N |
| XLogP | -0.43 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one?
The IUPAC name of (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one (CID 89024034) is (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one?
The canonical SMILES for (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one is C[C@H]1C=c2[nH]c(=O)oc2=CC1.
What is the InChIKey of (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one?
The InChIKey is GFHFXZJAUCJXCE-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-2-3-7-6(4-5)9-8(10)11-7/h3-5H,2H2,1H3,(H,9,10)/t5-/m1/s1.
What are the key properties of (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one?
(5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one has a molecular weight of 151.16 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 89024034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).