About 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide
2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 89024054) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide |
| PubChem CID | 89024054 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | C[C@@H]1C=CC=C(NC(=O)CN(C)C)C1 |
| InChI | InChI=1S/C11H18N2O/c1-9-5-4-6-10(7-9)12-11(14)8-13(2)3/h4-6,9H,7-8H2,1-3H3,(H,12,14)/t9-/m1/s1 |
| InChIKey | YDERTWRSFPOTMD-SECBINFHSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide?
The IUPAC name of 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide (CID 89024054) is 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide?
The canonical SMILES for 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide is C[C@@H]1C=CC=C(NC(=O)CN(C)C)C1.
What is the InChIKey of 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide?
The InChIKey is YDERTWRSFPOTMD-SECBINFHSA-N. The full InChI is InChI=1S/C11H18N2O/c1-9-5-4-6-10(7-9)12-11(14)8-13(2)3/h4-6,9H,7-8H2,1-3H3,(H,12,14)/t9-/m1/s1.
What are the key properties of 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide?
2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide has a molecular weight of 194.28 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]acetamide is sourced from PubChem (CID 89024054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).