About (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide
(4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 89024059) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 89024059 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1=CC[C@H](C)C=C1 |
| InChI | InChI=1S/C8H13NO2S/c1-7-3-5-8(6-4-7)12(10,11)9-2/h3,5-7,9H,4H2,1-2H3/t7-/m1/s1 |
| InChIKey | ZXKFJFMFROHABU-SSDOTTSWSA-N |
| XLogP | 1.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide (CID 89024059) is (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide is CNS(=O)(=O)C1=CC[C@H](C)C=C1.
What is the InChIKey of (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is ZXKFJFMFROHABU-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-7-3-5-8(6-4-7)12(10,11)9-2/h3,5-7,9H,4H2,1-2H3/t7-/m1/s1.
What are the key properties of (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide?
(4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 187.26 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N,4-dimethylcyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 89024059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).