About 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine
2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine (PubChem CID 89024296) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine |
| PubChem CID | 89024296 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine |
| SMILES | CC1C=C(CCN)C=CC1F |
| InChI | InChI=1S/C9H14FN/c1-7-6-8(4-5-11)2-3-9(7)10/h2-3,6-7,9H,4-5,11H2,1H3 |
| InChIKey | CNRKMXJVAGYEOP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine?
The IUPAC name of 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine (CID 89024296) is 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine.
What is the SMILES notation for 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine?
The canonical SMILES for 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine is CC1C=C(CCN)C=CC1F.
What is the InChIKey of 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine?
The InChIKey is CNRKMXJVAGYEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-7-6-8(4-5-11)2-3-9(7)10/h2-3,6-7,9H,4-5,11H2,1H3.
What are the key properties of 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine?
2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine has a molecular weight of 155.22 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methylcyclohexa-1,5-dien-1-yl)ethanamine is sourced from PubChem (CID 89024296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).