C26H35BrClN3S — CID 89025095
1-[7-bromo-1-(5-chloropentyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]ethenamine (PubChem CID 89025095) has the molecular formula C26H35BrClN3S and a molecular weight of 537.01 g/mol. Its IUPAC name is 1-[7-bromo-1-(5-chloropentyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]ethenamine.
| Compound Name | 1-[7-bromo-1-(5-chloropentyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]ethenamine |
|---|---|
| PubChem CID | 89025095 |
| Molecular Formula | C26H35BrClN3S |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 1-[7-bromo-1-(5-chloropentyl)-4,5-dihydrothieno[3,2-g]indazol-3-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]ethenamine |
| SMILES | C=C(NCC1CCC2CC1C2(C)C)c1nn(CCCCCCl)c2c1CCc1cc(Br)sc1-2 |
| InChI | InChI=1S/C26H35BrClN3S/c1-16(29-15-18-7-9-19-14-21(18)26(19,2)3)23-20-10-8-17-13-22(27)32-25(17)24(20)31(30-23)12-6-4-5-11-28/h13,18-19,21,29H,1,4-12,14-15H2,2-3H3 |
| InChIKey | JMZJLVWDTGVRNI-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|