C26H39F3N6O — CID 89025280
3-[4-[(3E,5Z)-6-aminohepta-1,3,5-trien-3-yl]piperazin-1-yl]-1-[(3R)-3-[[(3E,5Z)-7-amino-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]amino]pyrrolidin-1-yl]propan-1-one (PubChem CID 89025280) has the molecular formula C26H39F3N6O and a molecular weight of 508.63 g/mol. Its IUPAC name is 3-[4-[(3E,5Z)-6-aminohepta-1,3,5-trien-3-yl]piperazin-1-yl]-1-[(3R)-3-[[(3E,5Z)-7-amino-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]amino]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-[4-[(3E,5Z)-6-aminohepta-1,3,5-trien-3-yl]piperazin-1-yl]-1-[(3R)-3-[[(3E,5Z)-7-amino-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]amino]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 89025280 |
| Molecular Formula | C26H39F3N6O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 3-[4-[(3E,5Z)-6-aminohepta-1,3,5-trien-3-yl]piperazin-1-yl]-1-[(3R)-3-[[(3E,5Z)-7-amino-2-(trifluoromethyl)hepta-1,3,5-trien-4-yl]amino]pyrrolidin-1-yl]propan-1-one |
| SMILES | C=C/C(=C\C=C(\C)N)N1CCN(CCC(=O)N2CC[C@@H](NC(/C=C\CN)=C/C(=C)C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C26H39F3N6O/c1-4-24(8-7-21(3)31)34-16-14-33(15-17-34)12-10-25(36)35-13-9-23(19-35)32-22(6-5-11-30)18-20(2)26(27,28)29/h4-8,18,23,32H,1-2,9-17,19,30-31H2,3H3/b6-5-,21-7-,22-18+,24-8+/t23-/m1/s1 |
| InChIKey | DEPWYDQCFCUFNJ-LAQTUJHXSA-N |
| XLogP | 2.63 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|