About 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid
4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid (PubChem CID 89025285) has the molecular formula C10H20O3S
and a molecular weight of 220.33 g/mol. Its IUPAC name is 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid |
| PubChem CID | 89025285 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid |
| SMILES | CC(O)CSC(C)(C)CC(C)C(=O)O |
| InChI | InChI=1S/C10H20O3S/c1-7(9(12)13)5-10(3,4)14-6-8(2)11/h7-8,11H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | CQXSBLLQVSNZMQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid?
The IUPAC name of 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid (CID 89025285) is 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid.
What is the SMILES notation for 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid?
The canonical SMILES for 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid is CC(O)CSC(C)(C)CC(C)C(=O)O.
What is the InChIKey of 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid?
The InChIKey is CQXSBLLQVSNZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3S/c1-7(9(12)13)5-10(3,4)14-6-8(2)11/h7-8,11H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid?
4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid has a molecular weight of 220.33 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxypropylsulfanyl)-2,4-dimethylpentanoic acid is sourced from PubChem (CID 89025285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).