C17H24F3N3O2 — CID 89025289
tert-butyl 4-[4-amino-3-(trifluoromethyl)anilino]piperidine-1-carboxylate (PubChem CID 89025289) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-(trifluoromethyl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-(trifluoromethyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89025289 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl 4-[4-amino-3-(trifluoromethyl)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-16(2,3)25-15(24)23-8-6-11(7-9-23)22-12-4-5-14(21)13(10-12)17(18,19)20/h4-5,10-11,22H,6-9,21H2,1-3H3 |
| InChIKey | VQECSVCLAGWIHK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|