C6H8F3N3 — CID 89025329
(E)-3-(3,3,3-trifluoroprop-1-en-2-ylimino)prop-1-ene-1,2-diamine (PubChem CID 89025329) has the molecular formula C6H8F3N3 and a molecular weight of 179.15 g/mol. Its IUPAC name is (E)-3-(3,3,3-trifluoroprop-1-en-2-ylimino)prop-1-ene-1,2-diamine.
| Compound Name | (E)-3-(3,3,3-trifluoroprop-1-en-2-ylimino)prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 89025329 |
| Molecular Formula | C6H8F3N3 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (E)-3-(3,3,3-trifluoroprop-1-en-2-ylimino)prop-1-ene-1,2-diamine |
| SMILES | C=C(/N=C/C(N)=C\N)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3/c1-4(6(7,8)9)12-3-5(11)2-10/h2-3H,1,10-11H2/b5-2+,12-3+ |
| InChIKey | QUUXVCJPYVYKEM-FDXHQUMFSA-N |
| XLogP | 0.89 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|