C22H22ClFN6O2 — CID 89025531
1-[[(E)-3-amino-2-(ethenyliminomethyl)prop-2-enoyl]amino]-N-[[5-(2-chloro-4-fluoroanilino)-2-pyridinyl]methyl]cyclopropane-1-carboxamide (PubChem CID 89025531) has the molecular formula C22H22ClFN6O2 and a molecular weight of 456.91 g/mol. Its IUPAC name is 1-[[(E)-3-amino-2-(ethenyliminomethyl)prop-2-enoyl]amino]-N-[[5-(2-chloro-4-fluoroanilino)-2-pyridinyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[[(E)-3-amino-2-(ethenyliminomethyl)prop-2-enoyl]amino]-N-[[5-(2-chloro-4-fluoroanilino)-2-pyridinyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89025531 |
| Molecular Formula | C22H22ClFN6O2 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-[[(E)-3-amino-2-(ethenyliminomethyl)prop-2-enoyl]amino]-N-[[5-(2-chloro-4-fluoroanilino)-2-pyridinyl]methyl]cyclopropane-1-carboxamide |
| SMILES | C=C/N=C/C(=C\N)C(=O)NC1(C(=O)NCc2ccc(Nc3ccc(F)cc3Cl)cn2)CC1 |
| InChI | InChI=1S/C22H22ClFN6O2/c1-2-26-11-14(10-25)20(31)30-22(7-8-22)21(32)28-12-16-4-5-17(13-27-16)29-19-6-3-15(24)9-18(19)23/h2-6,9-11,13,29H,1,7-8,12,25H2,(H,28,32)(H,30,31)/b14-10+,26-11+ |
| InChIKey | MNERHOHMLJUNRS-GARPGXIGSA-N |
| XLogP | 2.94 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|