C19H22ClN7O — CID 89025572
(5S)-4-chloro-7-[(4-ethyl-3,5-dimethyl-2-pyridinyl)methyl]-5-(1,3,4-oxadiazol-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 89025572) has the molecular formula C19H22ClN7O and a molecular weight of 399.89 g/mol. Its IUPAC name is (5S)-4-chloro-7-[(4-ethyl-3,5-dimethyl-2-pyridinyl)methyl]-5-(1,3,4-oxadiazol-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | (5S)-4-chloro-7-[(4-ethyl-3,5-dimethyl-2-pyridinyl)methyl]-5-(1,3,4-oxadiazol-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89025572 |
| Molecular Formula | C19H22ClN7O |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (5S)-4-chloro-7-[(4-ethyl-3,5-dimethyl-2-pyridinyl)methyl]-5-(1,3,4-oxadiazol-2-ylmethyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1c(C)cnc(CN2C[C@@H](Cc3nnco3)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C19H22ClN7O/c1-4-13-10(2)6-22-14(11(13)3)8-27-7-12(5-15-26-23-9-28-15)16-17(20)24-19(21)25-18(16)27/h6,9,12H,4-5,7-8H2,1-3H3,(H2,21,24,25)/t12-/m1/s1 |
| InChIKey | IDJIOMMFSQVZTI-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |