About 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline
5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline (PubChem CID 89025753) has the molecular formula C15H13Cl2N3O4S
and a molecular weight of 402.26 g/mol. Its IUPAC name is 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline.
Molecular Properties
| Compound Name | 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline |
| PubChem CID | 89025753 |
| Molecular Formula | C15H13Cl2N3O4S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline |
| SMILES | NCc1cn(S(=O)(=O)c2ccc(Cl)c(N(O)O)c2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H13Cl2N3O4S/c16-10-1-4-14-12(5-10)9(7-18)8-19(14)25(23,24)11-2-3-13(17)15(6-11)20(21)22/h1-6,8,21-22H,7,18H2 |
| InChIKey | XVORWPWZAYPQSQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline?
The IUPAC name of 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline (CID 89025753) is 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline.
What is the SMILES notation for 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline?
The canonical SMILES for 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline is NCc1cn(S(=O)(=O)c2ccc(Cl)c(N(O)O)c2)c2ccc(Cl)cc12.
What is the InChIKey of 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline?
The InChIKey is XVORWPWZAYPQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O4S/c16-10-1-4-14-12(5-10)9(7-18)8-19(14)25(23,24)11-2-3-13(17)15(6-11)20(21)22/h1-6,8,21-22H,7,18H2.
What are the key properties of 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline?
5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline has a molecular weight of 402.26 g/mol, XLogP of 3.23, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(aminomethyl)-5-chloroindol-1-yl]sulfonyl-2-chloro-N,N-dihydroxyaniline is sourced from PubChem (CID 89025753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).