C25H35ClN8O2 — CID 89025910
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[4-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]piperazin-1-yl]-6-(4-chlorophenyl)-1,3,5-triazin-2-amine (PubChem CID 89025910) has the molecular formula C25H35ClN8O2 and a molecular weight of 515.06 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[4-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]piperazin-1-yl]-6-(4-chlorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[4-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]piperazin-1-yl]-6-(4-chlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 89025910 |
| Molecular Formula | C25H35ClN8O2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[4-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]piperazin-1-yl]-6-(4-chlorophenyl)-1,3,5-triazin-2-amine |
| SMILES | C=C(/C=C\C=C/N)N1CCN(c2nc(NCCOCCOCCN)nc(-c3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C25H35ClN8O2/c1-20(4-2-3-9-27)33-12-14-34(15-13-33)25-31-23(21-5-7-22(26)8-6-21)30-24(32-25)29-11-17-36-19-18-35-16-10-28/h2-9H,1,10-19,27-28H2,(H,29,30,31,32)/b4-2-,9-3- |
| InChIKey | VTTWNAMFTONJCH-XNQCMEONSA-N |
| XLogP | 2.26 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|