About 3-but-3-enyl-3,4-dimethylpiperazin-2-one
3-but-3-enyl-3,4-dimethylpiperazin-2-one (PubChem CID 89026045) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-but-3-enyl-3,4-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 3-but-3-enyl-3,4-dimethylpiperazin-2-one |
| PubChem CID | 89026045 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-but-3-enyl-3,4-dimethylpiperazin-2-one |
| SMILES | C=CCCC1(C)C(=O)NCCN1C |
| InChI | InChI=1S/C10H18N2O/c1-4-5-6-10(2)9(13)11-7-8-12(10)3/h4H,1,5-8H2,2-3H3,(H,11,13) |
| InChIKey | YVWDDBVFHOXBJS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-3,4-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-3,4-dimethylpiperazin-2-one?
The IUPAC name of 3-but-3-enyl-3,4-dimethylpiperazin-2-one (CID 89026045) is 3-but-3-enyl-3,4-dimethylpiperazin-2-one.
What is the SMILES notation for 3-but-3-enyl-3,4-dimethylpiperazin-2-one?
The canonical SMILES for 3-but-3-enyl-3,4-dimethylpiperazin-2-one is C=CCCC1(C)C(=O)NCCN1C.
What is the InChIKey of 3-but-3-enyl-3,4-dimethylpiperazin-2-one?
The InChIKey is YVWDDBVFHOXBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-4-5-6-10(2)9(13)11-7-8-12(10)3/h4H,1,5-8H2,2-3H3,(H,11,13).
What are the key properties of 3-but-3-enyl-3,4-dimethylpiperazin-2-one?
3-but-3-enyl-3,4-dimethylpiperazin-2-one has a molecular weight of 182.27 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-3,4-dimethylpiperazin-2-one is sourced from PubChem (CID 89026045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).