C6H10F2N2O — CID 89026210
3,3-difluoropiperidine-1-carboxamide (PubChem CID 89026210) has the molecular formula C6H10F2N2O and a molecular weight of 164.16 g/mol. Its IUPAC name is 3,3-difluoropiperidine-1-carboxamide.
| Compound Name | 3,3-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 89026210 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3,3-difluoropiperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C6H10F2N2O/c7-6(8)2-1-3-10(4-6)5(9)11/h1-4H2,(H2,9,11) |
| InChIKey | JOUBVHCHAAQKDL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |