C17H30N2OS — CID 89026512
N,4-dicyclohexyl-N-methyl-4-thionitrosobutanamide (PubChem CID 89026512) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is N,4-dicyclohexyl-N-methyl-4-thionitrosobutanamide.
| Compound Name | N,4-dicyclohexyl-N-methyl-4-thionitrosobutanamide |
|---|---|
| PubChem CID | 89026512 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N,4-dicyclohexyl-N-methyl-4-thionitrosobutanamide |
| SMILES | CN(C(=O)CCC(N=S)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H30N2OS/c1-19(15-10-6-3-7-11-15)17(20)13-12-16(18-21)14-8-4-2-5-9-14/h14-16H,2-13H2,1H3 |
| InChIKey | AQZBGLYJFOPYPB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |