C19H25FN2O2 — CID 89026585
prop-1-en-2-yl 9-(4-fluorophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 89026585) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is prop-1-en-2-yl 9-(4-fluorophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | prop-1-en-2-yl 9-(4-fluorophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 89026585 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | prop-1-en-2-yl 9-(4-fluorophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCC2(CC1)CCN(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C19H25FN2O2/c1-15(2)24-18(23)22-13-9-19(10-14-22)7-11-21(12-8-19)17-5-3-16(20)4-6-17/h3-6H,1,7-14H2,2H3 |
| InChIKey | YPRFEZSYJZXSPR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|