C29H36Cl2IN5O4 — CID 89026628
N-[(2R)-3-(2,4-dichlorophenyl)-1-[4-[3-[(2R)-2-(dimethylamino)-2-iodoethoxy]-2-pyridinyl]piperidin-1-yl]-1-oxopropan-2-yl]-2-oxa-6-azaspiro[3.3]heptane-6-carboxamide (PubChem CID 89026628) has the molecular formula C29H36Cl2IN5O4 and a molecular weight of 716.45 g/mol. Its IUPAC name is N-[(2R)-3-(2,4-dichlorophenyl)-1-[4-[3-[(2R)-2-(dimethylamino)-2-iodoethoxy]-2-pyridinyl]piperidin-1-yl]-1-oxopropan-2-yl]-2-oxa-6-azaspiro[3.3]heptane-6-carboxamide.
| Compound Name | N-[(2R)-3-(2,4-dichlorophenyl)-1-[4-[3-[(2R)-2-(dimethylamino)-2-iodoethoxy]-2-pyridinyl]piperidin-1-yl]-1-oxopropan-2-yl]-2-oxa-6-azaspiro[3.3]heptane-6-carboxamide |
|---|---|
| PubChem CID | 89026628 |
| Molecular Formula | C29H36Cl2IN5O4 |
| Molecular Weight | 716.45 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | N-[(2R)-3-(2,4-dichlorophenyl)-1-[4-[3-[(2R)-2-(dimethylamino)-2-iodoethoxy]-2-pyridinyl]piperidin-1-yl]-1-oxopropan-2-yl]-2-oxa-6-azaspiro[3.3]heptane-6-carboxamide |
| SMILES | CN(C)[C@H](I)COc1cccnc1C1CCN(C(=O)[C@@H](Cc2ccc(Cl)cc2Cl)NC(=O)N2CC3(COC3)C2)CC1 |
| InChI | InChI=1S/C29H36Cl2IN5O4/c1-35(2)25(32)14-41-24-4-3-9-33-26(24)19-7-10-36(11-8-19)27(38)23(12-20-5-6-21(30)13-22(20)31)34-28(39)37-15-29(16-37)17-40-18-29/h3-6,9,13,19,23,25H,7-8,10-12,14-18H2,1-2H3,(H,34,39)/t23-,25+/m1/s1 |
| InChIKey | JJAORYSTQLCRCK-NOZRDPDXSA-N |
| XLogP | 4.45 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|