C31H30N2O6 — CID 89026684
3-(5-butyl-1,3-dioxoisoindol-2-yl)-5-(7-butyl-4-oxo-1H-2,3-benzoxazin-3-yl)benzoic acid (PubChem CID 89026684) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is 3-(5-butyl-1,3-dioxoisoindol-2-yl)-5-(7-butyl-4-oxo-1H-2,3-benzoxazin-3-yl)benzoic acid.
| Compound Name | 3-(5-butyl-1,3-dioxoisoindol-2-yl)-5-(7-butyl-4-oxo-1H-2,3-benzoxazin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 89026684 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-(5-butyl-1,3-dioxoisoindol-2-yl)-5-(7-butyl-4-oxo-1H-2,3-benzoxazin-3-yl)benzoic acid |
| SMILES | CCCCc1ccc2c(c1)CON(c1cc(C(=O)O)cc(N3C(=O)c4ccc(CCCC)cc4C3=O)c1)C2=O |
| InChI | InChI=1S/C31H30N2O6/c1-3-5-7-19-9-11-25-22(13-19)18-39-33(30(25)36)24-16-21(31(37)38)15-23(17-24)32-28(34)26-12-10-20(8-6-4-2)14-27(26)29(32)35/h9-17H,3-8,18H2,1-2H3,(H,37,38) |
| InChIKey | LXHDXVZUOUNBHP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|