About 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde
3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 89026715) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| PubChem CID | 89026715 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=CC1=CNC2N=CC=CC12 |
| InChI | InChI=1S/C8H8N2O/c11-5-6-4-10-8-7(6)2-1-3-9-8/h1-5,7-8,10H |
| InChIKey | KYRZFILTKGKILL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde?
The IUPAC name of 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde (CID 89026715) is 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde.
What is the SMILES notation for 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde?
The canonical SMILES for 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde is O=CC1=CNC2N=CC=CC12.
What is the InChIKey of 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde?
The InChIKey is KYRZFILTKGKILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-5-6-4-10-8-7(6)2-1-3-9-8/h1-5,7-8,10H.
What are the key properties of 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde?
3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde has a molecular weight of 148.16 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde is sourced from PubChem (CID 89026715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).