About 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran
4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran (PubChem CID 89027315) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran |
| PubChem CID | 89027315 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran |
| SMILES | CC(C)C1=C(C(C)C)COCC1 |
| InChI | InChI=1S/C11H20O/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | HKRMLPWWOFCCDM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran?
The IUPAC name of 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran (CID 89027315) is 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran is CC(C)C1=C(C(C)C)COCC1.
What is the InChIKey of 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran?
The InChIKey is HKRMLPWWOFCCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-8(2)10-5-6-12-7-11(10)9(3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran?
4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran has a molecular weight of 168.28 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 89027315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).