C10H18O — CID 89027512
8-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene (PubChem CID 89027512) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 8-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene.
| Compound Name | 8-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
|---|---|
| PubChem CID | 89027512 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 8-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
| SMILES | CC1CCCC2CCOCC12 |
| InChI | InChI=1S/C10H18O/c1-8-3-2-4-9-5-6-11-7-10(8)9/h8-10H,2-7H2,1H3 |
| InChIKey | GOYVTWZDWSIENW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |