C30H40O8S2 — CID 89027601
bis(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) naphthalene-2,6-disulfonate (PubChem CID 89027601) has the molecular formula C30H40O8S2 and a molecular weight of 592.78 g/mol. Its IUPAC name is bis(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) naphthalene-2,6-disulfonate.
| Compound Name | bis(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) naphthalene-2,6-disulfonate |
|---|---|
| PubChem CID | 89027601 |
| Molecular Formula | C30H40O8S2 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | bis(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) naphthalene-2,6-disulfonate |
| SMILES | CC1(C)C2CC(OS(=O)(=O)c3ccc4cc(S(=O)(=O)OC5CC6CC(C6(C)C)C5(C)O)ccc4c3)C(C)(O)C1C2 |
| InChI | InChI=1S/C30H40O8S2/c1-27(2)19-13-23(27)29(5,31)25(15-19)37-39(33,34)21-9-7-18-12-22(10-8-17(18)11-21)40(35,36)38-26-16-20-14-24(28(20,3)4)30(26,6)32/h7-12,19-20,23-26,31-32H,13-16H2,1-6H3 |
| InChIKey | RRMKUIBFBBWYAK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|