C21H39NO4 — CID 89027738
(4aZ,6R,11aS)-2,2,9,9-tetramethyl-N-octyl-6,7,11,11a-tetrahydro-4H-[1,3]dioxino[4,5-e][1,3]dioxonin-6-amine (PubChem CID 89027738) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is (4aZ,6R,11aS)-2,2,9,9-tetramethyl-N-octyl-6,7,11,11a-tetrahydro-4H-[1,3]dioxino[4,5-e][1,3]dioxonin-6-amine.
| Compound Name | (4aZ,6R,11aS)-2,2,9,9-tetramethyl-N-octyl-6,7,11,11a-tetrahydro-4H-[1,3]dioxino[4,5-e][1,3]dioxonin-6-amine |
|---|---|
| PubChem CID | 89027738 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | (4aZ,6R,11aS)-2,2,9,9-tetramethyl-N-octyl-6,7,11,11a-tetrahydro-4H-[1,3]dioxino[4,5-e][1,3]dioxonin-6-amine |
| SMILES | CCCCCCCCN[C@@H]1/C=C2/COC(C)(C)O[C@@H]2COC(C)(C)OC1 |
| InChI | InChI=1S/C21H39NO4/c1-6-7-8-9-10-11-12-22-18-13-17-14-23-21(4,5)26-19(17)16-25-20(2,3)24-15-18/h13,18-19,22H,6-12,14-16H2,1-5H3/b17-13-/t18-,19-/m1/s1 |
| InChIKey | KOZXLPDYYFQEJI-NSTOGTKSSA-N |
| XLogP | 4.17 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|