C17H28F8O3 — CID 89028014
3-[2-ethyl-1,1-difluoro-2,3-dimethyl-3-(1,1,2,2-tetrafluoroethoxy)pentoxy]-2,2-difluoro-3-methylpentan-1-ol (PubChem CID 89028014) has the molecular formula C17H28F8O3 and a molecular weight of 432.39 g/mol. Its IUPAC name is 3-[2-ethyl-1,1-difluoro-2,3-dimethyl-3-(1,1,2,2-tetrafluoroethoxy)pentoxy]-2,2-difluoro-3-methylpentan-1-ol.
| Compound Name | 3-[2-ethyl-1,1-difluoro-2,3-dimethyl-3-(1,1,2,2-tetrafluoroethoxy)pentoxy]-2,2-difluoro-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 89028014 |
| Molecular Formula | C17H28F8O3 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-[2-ethyl-1,1-difluoro-2,3-dimethyl-3-(1,1,2,2-tetrafluoroethoxy)pentoxy]-2,2-difluoro-3-methylpentan-1-ol |
| SMILES | CCC(C)(OC(F)(F)C(C)(CC)C(C)(CC)OC(F)(F)C(F)F)C(F)(F)CO |
| InChI | InChI=1S/C17H28F8O3/c1-7-12(4,13(5,8-2)27-16(22,23)11(18)19)17(24,25)28-14(6,9-3)15(20,21)10-26/h11,26H,7-10H2,1-6H3 |
| InChIKey | ZERUQZRCRZQJQA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|