C14H23N3O — CID 89028261
1-cyclopentyl-2-imino-4,6,6-trimethyl-3-methylidene-1,4-diazepan-5-one (PubChem CID 89028261) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-cyclopentyl-2-imino-4,6,6-trimethyl-3-methylidene-1,4-diazepan-5-one.
| Compound Name | 1-cyclopentyl-2-imino-4,6,6-trimethyl-3-methylidene-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 89028261 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-cyclopentyl-2-imino-4,6,6-trimethyl-3-methylidene-1,4-diazepan-5-one |
| SMILES | [H]/N=C1\C(=C)N(C)C(=O)C(C)(C)CN1C1CCCC1 |
| InChI | InChI=1S/C14H23N3O/c1-10-12(15)17(11-7-5-6-8-11)9-14(2,3)13(18)16(10)4/h11,15H,1,5-9H2,2-4H3/b15-12+ |
| InChIKey | HLFKIAPHNMIXHC-NTCAYCPXSA-N |
| XLogP | 2.22 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|