C5H7N3O5 — CID 89028739
(2S,3R,4R)-3-hydroxy-2,4,5-trinitrosopentanal (PubChem CID 89028739) has the molecular formula C5H7N3O5 and a molecular weight of 189.13 g/mol. Its IUPAC name is (2S,3R,4R)-3-hydroxy-2,4,5-trinitrosopentanal.
| Compound Name | (2S,3R,4R)-3-hydroxy-2,4,5-trinitrosopentanal |
|---|---|
| PubChem CID | 89028739 |
| Molecular Formula | C5H7N3O5 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (2S,3R,4R)-3-hydroxy-2,4,5-trinitrosopentanal |
| SMILES | O=C[C@@H](N=O)[C@H](O)[C@@H](CN=O)N=O |
| InChI | InChI=1S/C5H7N3O5/c9-2-4(8-13)5(10)3(7-12)1-6-11/h2-5,10H,1H2/t3-,4-,5-/m1/s1 |
| InChIKey | WRSMKLJKQNQQCU-UOWFLXDJSA-N |
| XLogP | -0.42 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|