About (3R,4S)-2-methylideneoxane-3,4-diol
(3R,4S)-2-methylideneoxane-3,4-diol (PubChem CID 89028767) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (3R,4S)-2-methylideneoxane-3,4-diol.
Molecular Properties
| Compound Name | (3R,4S)-2-methylideneoxane-3,4-diol |
| PubChem CID | 89028767 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (3R,4S)-2-methylideneoxane-3,4-diol |
| SMILES | C=C1OCC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O3/c1-4-6(8)5(7)2-3-9-4/h5-8H,1-3H2/t5-,6-/m0/s1 |
| InChIKey | WUTCTSSNVIKVAD-WDSKDSINSA-N |
| XLogP | -0.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-2-methylideneoxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-2-methylideneoxane-3,4-diol?
The IUPAC name of (3R,4S)-2-methylideneoxane-3,4-diol (CID 89028767) is (3R,4S)-2-methylideneoxane-3,4-diol.
What is the SMILES notation for (3R,4S)-2-methylideneoxane-3,4-diol?
The canonical SMILES for (3R,4S)-2-methylideneoxane-3,4-diol is C=C1OCC[C@H](O)[C@H]1O.
What is the InChIKey of (3R,4S)-2-methylideneoxane-3,4-diol?
The InChIKey is WUTCTSSNVIKVAD-WDSKDSINSA-N. The full InChI is InChI=1S/C6H10O3/c1-4-6(8)5(7)2-3-9-4/h5-8H,1-3H2/t5-,6-/m0/s1.
What are the key properties of (3R,4S)-2-methylideneoxane-3,4-diol?
(3R,4S)-2-methylideneoxane-3,4-diol has a molecular weight of 130.14 g/mol, XLogP of -0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-2-methylideneoxane-3,4-diol is sourced from PubChem (CID 89028767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).