(2R)-3-hydroxy-2,3-dimethylbutanoic acid

C6H12O3 — CID 89028911

IUPAC(2R)-3-hydroxy-2,3-dimethylbutanoic acid
SMILESC[C@@H](C(=O)O)C(C)(C)O
InChIInChI=1S/C6H12O3/c1-4(5(7)8)6(2,3)9/h4,9H,1-3H3,(H,7,8)/t4-/m0/s1
InChIKeyFKMQLWUMYSBWQE-BYPYZUCNSA-N
MW132.16 g/mol
LogP0.48
Rot. Bonds2

About (2R)-3-hydroxy-2,3-dimethylbutanoic acid

(2R)-3-hydroxy-2,3-dimethylbutanoic acid (PubChem CID 89028911) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R)-3-hydroxy-2,3-dimethylbutanoic acid.

Molecular Properties

Compound Name(2R)-3-hydroxy-2,3-dimethylbutanoic acid
PubChem CID89028911
Molecular FormulaC6H12O3
Molecular Weight132.16 g/mol
Exact Mass132.08
IUPAC Name(2R)-3-hydroxy-2,3-dimethylbutanoic acid
SMILESC[C@@H](C(=O)O)C(C)(C)O
InChIInChI=1S/C6H12O3/c1-4(5(7)8)6(2,3)9/h4,9H,1-3H3,(H,7,8)/t4-/m0/s1
InChIKeyFKMQLWUMYSBWQE-BYPYZUCNSA-N
XLogP0.48
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.16
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-3-hydroxy-2,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-hydroxy-2,3-dimethylbutanoic acid?
The IUPAC name of (2R)-3-hydroxy-2,3-dimethylbutanoic acid (CID 89028911) is (2R)-3-hydroxy-2,3-dimethylbutanoic acid.
What is the SMILES notation for (2R)-3-hydroxy-2,3-dimethylbutanoic acid?
The canonical SMILES for (2R)-3-hydroxy-2,3-dimethylbutanoic acid is C[C@@H](C(=O)O)C(C)(C)O.
What is the InChIKey of (2R)-3-hydroxy-2,3-dimethylbutanoic acid?
The InChIKey is FKMQLWUMYSBWQE-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H12O3/c1-4(5(7)8)6(2,3)9/h4,9H,1-3H3,(H,7,8)/t4-/m0/s1.
What are the key properties of (2R)-3-hydroxy-2,3-dimethylbutanoic acid?
(2R)-3-hydroxy-2,3-dimethylbutanoic acid has a molecular weight of 132.16 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-hydroxy-2,3-dimethylbutanoic acid is sourced from PubChem (CID 89028911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).