C21H17ClN4O2S — CID 89028954
2-(2-amino-3-chloroanilino)-5-benzylsulfanyl-1H-benzimidazole-4-carboxylic acid (PubChem CID 89028954) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-(2-amino-3-chloroanilino)-5-benzylsulfanyl-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-(2-amino-3-chloroanilino)-5-benzylsulfanyl-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 89028954 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(2-amino-3-chloroanilino)-5-benzylsulfanyl-1H-benzimidazole-4-carboxylic acid |
| SMILES | Nc1c(Cl)cccc1Nc1nc2c(C(=O)O)c(SCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C21H17ClN4O2S/c22-13-7-4-8-14(18(13)23)24-21-25-15-9-10-16(17(20(27)28)19(15)26-21)29-11-12-5-2-1-3-6-12/h1-10H,11,23H2,(H,27,28)(H2,24,25,26) |
| InChIKey | CEXJEXHAMWNLFL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|