C33H42N2 — CID 89029087
(4E,6E,8E)-9-N-cyclohexa-2,4-dien-1-yl-5-ethenyl-2-N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexa-1,3-dien-1-yl]-6-methylundeca-4,6,8,10-tetraene-2,9-diamine (PubChem CID 89029087) has the molecular formula C33H42N2 and a molecular weight of 466.71 g/mol. Its IUPAC name is (4E,6E,8E)-9-N-cyclohexa-2,4-dien-1-yl-5-ethenyl-2-N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexa-1,3-dien-1-yl]-6-methylundeca-4,6,8,10-tetraene-2,9-diamine.
| Compound Name | (4E,6E,8E)-9-N-cyclohexa-2,4-dien-1-yl-5-ethenyl-2-N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexa-1,3-dien-1-yl]-6-methylundeca-4,6,8,10-tetraene-2,9-diamine |
|---|---|
| PubChem CID | 89029087 |
| Molecular Formula | C33H42N2 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (4E,6E,8E)-9-N-cyclohexa-2,4-dien-1-yl-5-ethenyl-2-N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]cyclohexa-1,3-dien-1-yl]-6-methylundeca-4,6,8,10-tetraene-2,9-diamine |
| SMILES | C=C/C=C\C=C(/C)C1=CC=C(NC(C)C/C=C(C=C)/C(C)=C/C=C(\C=C)NC2C=CC=CC2)CC1 |
| InChI | InChI=1S/C33H42N2/c1-7-10-12-15-26(4)30-21-24-33(25-22-30)34-28(6)19-20-29(8-2)27(5)18-23-31(9-3)35-32-16-13-11-14-17-32/h7-16,18,20-21,23-24,28,32,34-35H,1-3,17,19,22,25H2,4-6H3/b12-10-,26-15+,27-18+,29-20+,31-23+ |
| InChIKey | QLXBUVXZQHWTBG-KUKHBKSBSA-N |
| XLogP | 8.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|