C18H25N — CID 89029099
3-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-amine (PubChem CID 89029099) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 3-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89029099 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 3-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=C/C=C\C=C(/C)NC1CC=CC(CC)=C1/C=C\C |
| InChI | InChI=1S/C18H25N/c1-5-8-9-12-15(4)19-18-14-10-13-16(7-3)17(18)11-6-2/h5-6,8-13,18-19H,1,7,14H2,2-4H3/b9-8-,11-6-,15-12+ |
| InChIKey | ZAWMMSGWKHMODF-INOTUCNHSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|