C16H22O — CID 89029169
2-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]cyclohexene-1-carbaldehyde (PubChem CID 89029169) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]cyclohexene-1-carbaldehyde.
| Compound Name | 2-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 89029169 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]cyclohexene-1-carbaldehyde |
| SMILES | C/C=C\C(=C/C(C)=C\C)C1=C(C=O)CCCC1 |
| InChI | InChI=1S/C16H22O/c1-4-8-14(11-13(3)5-2)16-10-7-6-9-15(16)12-17/h4-5,8,11-12H,6-7,9-10H2,1-3H3/b8-4-,13-5-,14-11+ |
| InChIKey | BXHVOZCDNDSWAZ-PYFWWVFMSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|