C8H8INO — CID 89029210
5-iodo-1,3,5,6-tetrahydroindol-2-one (PubChem CID 89029210) has the molecular formula C8H8INO and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-iodo-1,3,5,6-tetrahydroindol-2-one.
| Compound Name | 5-iodo-1,3,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 89029210 |
| Molecular Formula | C8H8INO |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5-iodo-1,3,5,6-tetrahydroindol-2-one |
| SMILES | O=C1CC2=CC(I)CC=C2N1 |
| InChI | InChI=1S/C8H8INO/c9-6-1-2-7-5(3-6)4-8(11)10-7/h2-3,6H,1,4H2,(H,10,11) |
| InChIKey | PZJQJJSQKCWROP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|