C15H18O4 — CID 89029253
formyl 2,4,7,7,7a-pentamethyl-1-benzofuran-6-carboxylate (PubChem CID 89029253) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is formyl 2,4,7,7,7a-pentamethyl-1-benzofuran-6-carboxylate.
| Compound Name | formyl 2,4,7,7,7a-pentamethyl-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 89029253 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | formyl 2,4,7,7,7a-pentamethyl-1-benzofuran-6-carboxylate |
| SMILES | CC1=CC2=C(C)C=C(C(=O)OC=O)C(C)(C)C2(C)O1 |
| InChI | InChI=1S/C15H18O4/c1-9-6-12(13(17)18-8-16)14(3,4)15(5)11(9)7-10(2)19-15/h6-8H,1-5H3 |
| InChIKey | NSJDPUMMPDFHRN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|