C9H11NO — CID 89029271
5-methyl-1,3,5,6-tetrahydroindol-2-one (PubChem CID 89029271) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 5-methyl-1,3,5,6-tetrahydroindol-2-one.
| Compound Name | 5-methyl-1,3,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 89029271 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5-methyl-1,3,5,6-tetrahydroindol-2-one |
| SMILES | CC1C=C2CC(=O)NC2=CC1 |
| InChI | InChI=1S/C9H11NO/c1-6-2-3-8-7(4-6)5-9(11)10-8/h3-4,6H,2,5H2,1H3,(H,10,11) |
| InChIKey | CMYVGZBHCQMPPM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |