About 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine
7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine (PubChem CID 89029377) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine |
| PubChem CID | 89029377 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine |
| SMILES | Cc1cc2c(cn1)OCCS2 |
| InChI | InChI=1S/C8H9NOS/c1-6-4-8-7(5-9-6)10-2-3-11-8/h4-5H,2-3H2,1H3 |
| InChIKey | SZXKLFDAKDMMBZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine?
The IUPAC name of 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine (CID 89029377) is 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine.
What is the SMILES notation for 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine?
The canonical SMILES for 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine is Cc1cc2c(cn1)OCCS2.
What is the InChIKey of 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine?
The InChIKey is SZXKLFDAKDMMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-6-4-8-7(5-9-6)10-2-3-11-8/h4-5H,2-3H2,1H3.
What are the key properties of 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine?
7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine has a molecular weight of 167.23 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydro-[1,4]oxathiino[2,3-c]pyridine is sourced from PubChem (CID 89029377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).