C35H32N2O5 — CID 89029395
2-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[2-(4-prop-1-en-2-ylphenyl)propan-2-yl]carbamate (PubChem CID 89029395) has the molecular formula C35H32N2O5 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[2-(4-prop-1-en-2-ylphenyl)propan-2-yl]carbamate.
| Compound Name | 2-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[2-(4-prop-1-en-2-ylphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 89029395 |
| Molecular Formula | C35H32N2O5 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[2-(4-prop-1-en-2-ylphenyl)propan-2-yl]carbamate |
| SMILES | C=C(C)c1ccc(C(C)(C)NC(=O)OCCc2ccc(Nc3ccc(O)c4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C35H32N2O5/c1-21(2)23-11-13-24(14-12-23)35(3,4)37-34(41)42-20-19-22-9-15-25(16-10-22)36-28-17-18-29(38)31-30(28)32(39)26-7-5-6-8-27(26)33(31)40/h5-18,36,38H,1,19-20H2,2-4H3,(H,37,41) |
| InChIKey | TYJODWPNVHZRFD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|