About 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine
6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine (PubChem CID 89029422) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine |
| PubChem CID | 89029422 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine |
| SMILES | c1cc2c(nn1)OCCO2 |
| InChI | InChI=1S/C6H6N2O2/c1-2-7-8-6-5(1)9-3-4-10-6/h1-2H,3-4H2 |
| InChIKey | GSBNHPMPEBPESH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine?
The IUPAC name of 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine (CID 89029422) is 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine.
What is the SMILES notation for 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine?
The canonical SMILES for 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine is c1cc2c(nn1)OCCO2.
What is the InChIKey of 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine?
The InChIKey is GSBNHPMPEBPESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-2-7-8-6-5(1)9-3-4-10-6/h1-2H,3-4H2.
What are the key properties of 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine?
6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine has a molecular weight of 138.13 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-[1,4]dioxino[2,3-c]pyridazine is sourced from PubChem (CID 89029422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).