C20H26O6 — CID 89030219
(3,5-dihydroxy-2,7-dimethyl-1-adamantyl) 3-prop-2-enoyloxycyclobut-2-ene-1-carboxylate (PubChem CID 89030219) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (3,5-dihydroxy-2,7-dimethyl-1-adamantyl) 3-prop-2-enoyloxycyclobut-2-ene-1-carboxylate.
| Compound Name | (3,5-dihydroxy-2,7-dimethyl-1-adamantyl) 3-prop-2-enoyloxycyclobut-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 89030219 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3,5-dihydroxy-2,7-dimethyl-1-adamantyl) 3-prop-2-enoyloxycyclobut-2-ene-1-carboxylate |
| SMILES | C=CC(=O)OC1=CC(C(=O)OC23CC4(C)CC(O)(CC(O)(C4)C2C)C3)C1 |
| InChI | InChI=1S/C20H26O6/c1-4-15(21)25-14-5-13(6-14)16(22)26-20-9-17(3)7-18(23,11-20)10-19(24,8-17)12(20)2/h4-5,12-13,23-24H,1,6-11H2,2-3H3 |
| InChIKey | OIENFHSROSUBEG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|