About (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one
(4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one (PubChem CID 89030305) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one |
| PubChem CID | 89030305 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one |
| SMILES | O=C1CC(CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C7H12O5/c8-2-3-1-4(9)6(11)7(12)5(3)10/h3,5-8,10-12H,1-2H2/t3?,5-,6?,7?/m1/s1 |
| InChIKey | ACVTTWBZLGNMCH-DZSYHBDJSA-N |
| XLogP | -2.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one?
The IUPAC name of (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one (CID 89030305) is (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one.
What is the SMILES notation for (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one?
The canonical SMILES for (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one is O=C1CC(CO)[C@@H](O)C(O)C1O.
What is the InChIKey of (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one?
The InChIKey is ACVTTWBZLGNMCH-DZSYHBDJSA-N. The full InChI is InChI=1S/C7H12O5/c8-2-3-1-4(9)6(11)7(12)5(3)10/h3,5-8,10-12H,1-2H2/t3?,5-,6?,7?/m1/s1.
What are the key properties of (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one?
(4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one has a molecular weight of 176.17 g/mol, XLogP of -2.35, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexan-1-one is sourced from PubChem (CID 89030305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).